About O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate
O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate (PubChem CID 175152556) has the molecular formula C8H17NOS2
and a molecular weight of 207.36 g/mol. Its IUPAC name is O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate.
Molecular Properties
| Compound Name | O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate |
| PubChem CID | 175152556 |
| Molecular Formula | C8H17NOS2 |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate |
| SMILES | COC(=S)SN(C(C)C)C(C)C |
| InChI | InChI=1S/C8H17NOS2/c1-6(2)9(7(3)4)12-8(11)10-5/h6-7H,1-5H3 |
| InChIKey | HIKCPHKPDQAVEG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate?
The IUPAC name of O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate (CID 175152556) is O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate.
What is the SMILES notation for O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate?
The canonical SMILES for O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate is COC(=S)SN(C(C)C)C(C)C.
What is the InChIKey of O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate?
The InChIKey is HIKCPHKPDQAVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NOS2/c1-6(2)9(7(3)4)12-8(11)10-5/h6-7H,1-5H3.
What are the key properties of O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate?
O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate has a molecular weight of 207.36 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl [di(propan-2-yl)amino]sulfanylmethanethioate is sourced from PubChem (CID 175152556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).