C14H31N3O2S4+2 — CID 173259345
(S)-dithiocarboxy-[[(S)-dithiocarboxy-ethyl-[(2R)-2-methoxypropyl]azaniumyl]amino]-ethyl-[(2R)-2-methoxypropyl]azanium (PubChem CID 173259345) has the molecular formula C14H31N3O2S4+2 and a molecular weight of 401.69 g/mol. Its IUPAC name is (S)-dithiocarboxy-[[(S)-dithiocarboxy-ethyl-[(2R)-2-methoxypropyl]azaniumyl]amino]-ethyl-[(2R)-2-methoxypropyl]azanium.
| Compound Name | (S)-dithiocarboxy-[[(S)-dithiocarboxy-ethyl-[(2R)-2-methoxypropyl]azaniumyl]amino]-ethyl-[(2R)-2-methoxypropyl]azanium |
|---|---|
| PubChem CID | 173259345 |
| Molecular Formula | C14H31N3O2S4+2 |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | (S)-dithiocarboxy-[[(S)-dithiocarboxy-ethyl-[(2R)-2-methoxypropyl]azaniumyl]amino]-ethyl-[(2R)-2-methoxypropyl]azanium |
| SMILES | CC[N@@+](C[C@@H](C)OC)(N[N@@+](CC)(C[C@@H](C)OC)C(=S)S)C(=S)S |
| InChI | InChI=1S/C14H29N3O2S4/c1-7-16(13(20)21,9-11(3)18-5)15-17(8-2,14(22)23)10-12(4)19-6/h11-12,15H,7-10H2,1-6H3/p+2/t11-,12-,16+,17+/m1/s1 |
| InChIKey | ZXSUCTUHHJUXQK-UDVXPWBQSA-P |
| XLogP | 2.58 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|