About O-methyl 3-hydroxybutanethioate
O-methyl 3-hydroxybutanethioate (PubChem CID 87475263) has the molecular formula C5H10O2S
and a molecular weight of 134.20 g/mol. Its IUPAC name is O-methyl 3-hydroxybutanethioate.
Molecular Properties
| Compound Name | O-methyl 3-hydroxybutanethioate |
| PubChem CID | 87475263 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | O-methyl 3-hydroxybutanethioate |
| SMILES | COC(=S)CC(C)O |
| InChI | InChI=1S/C5H10O2S/c1-4(6)3-5(8)7-2/h4,6H,3H2,1-2H3 |
| InChIKey | VRMVMCJXEGOTFX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl 3-hydroxybutanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl 3-hydroxybutanethioate?
The IUPAC name of O-methyl 3-hydroxybutanethioate (CID 87475263) is O-methyl 3-hydroxybutanethioate.
What is the SMILES notation for O-methyl 3-hydroxybutanethioate?
The canonical SMILES for O-methyl 3-hydroxybutanethioate is COC(=S)CC(C)O.
What is the InChIKey of O-methyl 3-hydroxybutanethioate?
The InChIKey is VRMVMCJXEGOTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S/c1-4(6)3-5(8)7-2/h4,6H,3H2,1-2H3.
What are the key properties of O-methyl 3-hydroxybutanethioate?
O-methyl 3-hydroxybutanethioate has a molecular weight of 134.20 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl 3-hydroxybutanethioate is sourced from PubChem (CID 87475263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).