About O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate
O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate (PubChem CID 20610392) has the molecular formula C7H15NOS2
and a molecular weight of 193.34 g/mol. Its IUPAC name is O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate |
| PubChem CID | 20610392 |
| Molecular Formula | C7H15NOS2 |
| Molecular Weight | 193.34 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate |
| SMILES | CC(C)NOC(=S)SC(C)C |
| InChI | InChI=1S/C7H15NOS2/c1-5(2)8-9-7(10)11-6(3)4/h5-6,8H,1-4H3 |
| InChIKey | VPCMGCSIQVKHIX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate?
The IUPAC name of O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate (CID 20610392) is O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate.
What is the SMILES notation for O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate?
The canonical SMILES for O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate is CC(C)NOC(=S)SC(C)C.
What is the InChIKey of O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate?
The InChIKey is VPCMGCSIQVKHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NOS2/c1-5(2)8-9-7(10)11-6(3)4/h5-6,8H,1-4H3.
What are the key properties of O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate?
O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate has a molecular weight of 193.34 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(propan-2-ylamino) propan-2-ylsulfanylmethanethioate is sourced from PubChem (CID 20610392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).