C24H28N4O3 — CID 175156029
7-[(5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]heptanoic acid (PubChem CID 175156029) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 7-[(5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 175156029 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 7-[(5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carbonyl)amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)N1CCc2c(c3ccccc3n2-c2ccccn2)C1 |
| InChI | InChI=1S/C24H28N4O3/c29-23(30)12-3-1-2-7-15-26-24(31)27-16-13-21-19(17-27)18-9-4-5-10-20(18)28(21)22-11-6-8-14-25-22/h4-6,8-11,14H,1-3,7,12-13,15-17H2,(H,26,31)(H,29,30) |
| InChIKey | HPSHANLRMNGRAH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|