C24H29N5O3 — CID 156776134
N-[7-(hydroxyamino)-7-oxoheptyl]-5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide (PubChem CID 156776134) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 156776134 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-5-pyridin-2-yl-3,4-dihydro-1H-pyrido[4,3-b]indole-2-carboxamide |
| SMILES | O=C(CCCCCCNC(=O)N1CCc2c(c3ccccc3n2-c2ccccn2)C1)NO |
| InChI | InChI=1S/C24H29N5O3/c30-23(27-32)12-3-1-2-7-15-26-24(31)28-16-13-21-19(17-28)18-9-4-5-10-20(18)29(21)22-11-6-8-14-25-22/h4-6,8-11,14,32H,1-3,7,12-13,15-17H2,(H,26,31)(H,27,30) |
| InChIKey | XMPSONJTUVQRNT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|