About hydride;tris(2-methylpropyl)stannane
hydride;tris(2-methylpropyl)stannane (PubChem CID 175158031) has the molecular formula C12H29Sn-
and a molecular weight of 292.07 g/mol. Its IUPAC name is hydride;tris(2-methylpropyl)stannane.
Molecular Properties
| Compound Name | hydride;tris(2-methylpropyl)stannane |
| PubChem CID | 175158031 |
| Molecular Formula | C12H29Sn- |
| Molecular Weight | 292.07 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | hydride;tris(2-methylpropyl)stannane |
| SMILES | CC(C)C[SnH](CC(C)C)CC(C)C.[H-] |
| InChI | InChI=1S/3C4H9.Sn.2H/c3*1-4(2)3;;;/h3*4H,1H2,2-3H3;;;/q;;;;;-1 |
| InChIKey | KBGPZUJPBBUFTP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.07 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hydride;tris(2-methylpropyl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;tris(2-methylpropyl)stannane?
The IUPAC name of hydride;tris(2-methylpropyl)stannane (CID 175158031) is hydride;tris(2-methylpropyl)stannane.
What is the SMILES notation for hydride;tris(2-methylpropyl)stannane?
The canonical SMILES for hydride;tris(2-methylpropyl)stannane is CC(C)C[SnH](CC(C)C)CC(C)C.[H-].
What is the InChIKey of hydride;tris(2-methylpropyl)stannane?
The InChIKey is KBGPZUJPBBUFTP-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.Sn.2H/c3*1-4(2)3;;;/h3*4H,1H2,2-3H3;;;/q;;;;;-1.
What are the key properties of hydride;tris(2-methylpropyl)stannane?
hydride;tris(2-methylpropyl)stannane has a molecular weight of 292.07 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;tris(2-methylpropyl)stannane is sourced from PubChem (CID 175158031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).