About CID 22934999
CID 22934999 (PubChem CID 22934999) has the molecular formula C4H9Al+
and a molecular weight of 84.10 g/mol.
Molecular Properties
| Compound Name | CID 22934999 |
| PubChem CID | 22934999 |
| Molecular Formula | C4H9Al+ |
| Molecular Weight | 84.10 g/mol |
| Exact Mass | 84.05 |
| IUPAC Name | — |
| SMILES | CC(C)C[Al+] |
| InChI | InChI=1S/C4H9.Al/c1-4(2)3;/h4H,1H2,2-3H3;/q;+1 |
| InChIKey | WZTGFDUVZSNMCC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.10 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 22934999 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22934999?
The IUPAC name of CID 22934999 (CID 22934999) is not available.
What is the SMILES notation for CID 22934999?
The canonical SMILES for CID 22934999 is CC(C)C[Al+].
What is the InChIKey of CID 22934999?
The InChIKey is WZTGFDUVZSNMCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.Al/c1-4(2)3;/h4H,1H2,2-3H3;/q;+1.
What are the key properties of CID 22934999?
CID 22934999 has a molecular weight of 84.10 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22934999 is sourced from PubChem (CID 22934999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).