About Germane, (2-methylpropyl)-
Germane, (2-methylpropyl)- (PubChem CID 57473004) has the molecular formula C4H9Ge
and a molecular weight of 129.73 g/mol.
Molecular Properties
| Compound Name | Germane, (2-methylpropyl)- |
| PubChem CID | 57473004 |
| Molecular Formula | C4H9Ge |
| Molecular Weight | 129.73 g/mol |
| Exact Mass | 130.99 |
| IUPAC Name | — |
| SMILES | CC(C)C[Ge] |
| InChI | InChI=1S/C4H9Ge/c1-4(2)3-5/h4H,3H2,1-2H3 |
| InChIKey | XCLKKWIIZMHQIV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Germane, (2-methylpropyl)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Germane, (2-methylpropyl)-?
The IUPAC name of Germane, (2-methylpropyl)- (CID 57473004) is not available.
What is the SMILES notation for Germane, (2-methylpropyl)-?
The canonical SMILES for Germane, (2-methylpropyl)- is CC(C)C[Ge].
What is the InChIKey of Germane, (2-methylpropyl)-?
The InChIKey is XCLKKWIIZMHQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9Ge/c1-4(2)3-5/h4H,3H2,1-2H3.
What are the key properties of Germane, (2-methylpropyl)-?
Germane, (2-methylpropyl)- has a molecular weight of 129.73 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Germane, (2-methylpropyl)- is sourced from PubChem (CID 57473004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).