C22H31N5O6 — CID 175162586
(2S)-2-[[(2S)-3-acetamido-2-(adamantane-1-carbonylamino)propanoyl]amino]-6-diazo-5-oxohexanoic acid (PubChem CID 175162586) has the molecular formula C22H31N5O6 and a molecular weight of 461.52 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-acetamido-2-(adamantane-1-carbonylamino)propanoyl]amino]-6-diazo-5-oxohexanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-acetamido-2-(adamantane-1-carbonylamino)propanoyl]amino]-6-diazo-5-oxohexanoic acid |
|---|---|
| PubChem CID | 175162586 |
| Molecular Formula | C22H31N5O6 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-2-[[(2S)-3-acetamido-2-(adamantane-1-carbonylamino)propanoyl]amino]-6-diazo-5-oxohexanoic acid |
| SMILES | CC(=O)NC[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)N[C@@H](CCC(=O)C=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C22H31N5O6/c1-12(28)24-11-18(19(30)26-17(20(31)32)3-2-16(29)10-25-23)27-21(33)22-7-13-4-14(8-22)6-15(5-13)9-22/h10,13-15,17-18H,2-9,11H2,1H3,(H,24,28)(H,26,30)(H,27,33)(H,31,32)/t13?,14?,15?,17-,18-,22?/m0/s1 |
| InChIKey | HZUOBIQPTRAALC-OUNLHLBDSA-N |
| XLogP | 0.04 |
| TPSA | 178.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|