C20H37N5O4 — CID 175162982
[(5R)-5-amino-6-[4-(cyclopropylcarbamoylamino)piperidin-1-yl]-6-oxohexyl] N-tert-butylcarbamate (PubChem CID 175162982) has the molecular formula C20H37N5O4 and a molecular weight of 411.55 g/mol. Its IUPAC name is [(5R)-5-amino-6-[4-(cyclopropylcarbamoylamino)piperidin-1-yl]-6-oxohexyl] N-tert-butylcarbamate.
| Compound Name | [(5R)-5-amino-6-[4-(cyclopropylcarbamoylamino)piperidin-1-yl]-6-oxohexyl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175162982 |
| Molecular Formula | C20H37N5O4 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | [(5R)-5-amino-6-[4-(cyclopropylcarbamoylamino)piperidin-1-yl]-6-oxohexyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCC[C@@H](N)C(=O)N1CCC(NC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C20H37N5O4/c1-20(2,3)24-19(28)29-13-5-4-6-16(21)17(26)25-11-9-15(10-12-25)23-18(27)22-14-7-8-14/h14-16H,4-13,21H2,1-3H3,(H,24,28)(H2,22,23,27)/t16-/m1/s1 |
| InChIKey | GPNUGMRYSQIKNW-MRXNPFEDSA-N |
| XLogP | 1.46 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|