C11H16O4 — CID 175163345
2,3-dihydrofuran-2-yl prop-2-enoate;oxolane (PubChem CID 175163345) has the molecular formula C11H16O4 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2,3-dihydrofuran-2-yl prop-2-enoate;oxolane.
| Compound Name | 2,3-dihydrofuran-2-yl prop-2-enoate;oxolane |
|---|---|
| PubChem CID | 175163345 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2,3-dihydrofuran-2-yl prop-2-enoate;oxolane |
| SMILES | C1CCOC1.C=CC(=O)OC1CC=CO1 |
| InChI | InChI=1S/C7H8O3.C4H8O/c1-2-6(8)10-7-4-3-5-9-7;1-2-4-5-3-1/h2-3,5,7H,1,4H2;1-4H2 |
| InChIKey | BFWADKNNBPELQY-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|