C34H37F2N7O8 — CID 175163554
N-(3,5-difluorophenyl)-2-[2-[5-[[2-(1,3,2-dioxazinan-4-yl)-1,3,2-benzodioxazol-5-yl]amino]pentylcarbamoyl]-1H-indol-5-yl]-5-hydroxy-N-methyl-1,2-oxazolidine-5-carboxamide (PubChem CID 175163554) has the molecular formula C34H37F2N7O8 and a molecular weight of 709.71 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-2-[2-[5-[[2-(1,3,2-dioxazinan-4-yl)-1,3,2-benzodioxazol-5-yl]amino]pentylcarbamoyl]-1H-indol-5-yl]-5-hydroxy-N-methyl-1,2-oxazolidine-5-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-2-[2-[5-[[2-(1,3,2-dioxazinan-4-yl)-1,3,2-benzodioxazol-5-yl]amino]pentylcarbamoyl]-1H-indol-5-yl]-5-hydroxy-N-methyl-1,2-oxazolidine-5-carboxamide |
|---|---|
| PubChem CID | 175163554 |
| Molecular Formula | C34H37F2N7O8 |
| Molecular Weight | 709.71 g/mol |
| Exact Mass | 709.27 |
| IUPAC Name | N-(3,5-difluorophenyl)-2-[2-[5-[[2-(1,3,2-dioxazinan-4-yl)-1,3,2-benzodioxazol-5-yl]amino]pentylcarbamoyl]-1H-indol-5-yl]-5-hydroxy-N-methyl-1,2-oxazolidine-5-carboxamide |
| SMILES | CN(C(=O)C1(O)CCN(c2ccc3[nH]c(C(=O)NCCCCCNc4ccc5c(c4)ON(C4CCONO4)O5)cc3c2)O1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C34H37F2N7O8/c1-41(26-18-22(35)17-23(36)19-26)33(45)34(46)10-13-42(51-34)25-6-7-27-21(15-25)16-28(39-27)32(44)38-12-4-2-3-11-37-24-5-8-29-30(20-24)50-43(49-29)31-9-14-47-40-48-31/h5-8,15-20,31,37,39-40,46H,2-4,9-14H2,1H3,(H,38,44) |
| InChIKey | FDUARRYNWJODIS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 162.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|