About 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide
9-ethyl-N,N-bis(sulfanyl)tridecanethioamide (PubChem CID 175163946) has the molecular formula C15H31NS3
and a molecular weight of 321.62 g/mol. Its IUPAC name is 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide.
Molecular Properties
| Compound Name | 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide |
| PubChem CID | 175163946 |
| Molecular Formula | C15H31NS3 |
| Molecular Weight | 321.62 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide |
| SMILES | CCCCC(CC)CCCCCCCC(=S)N(S)S |
| InChI | InChI=1S/C15H31NS3/c1-3-5-11-14(4-2)12-9-7-6-8-10-13-15(17)16(18)19/h14,18-19H,3-13H2,1-2H3 |
| InChIKey | JQAUZYGDLHZXJU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide?
The IUPAC name of 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide (CID 175163946) is 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide.
What is the SMILES notation for 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide?
The canonical SMILES for 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide is CCCCC(CC)CCCCCCCC(=S)N(S)S.
What is the InChIKey of 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide?
The InChIKey is JQAUZYGDLHZXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NS3/c1-3-5-11-14(4-2)12-9-7-6-8-10-13-15(17)16(18)19/h14,18-19H,3-13H2,1-2H3.
What are the key properties of 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide?
9-ethyl-N,N-bis(sulfanyl)tridecanethioamide has a molecular weight of 321.62 g/mol, XLogP of 6.25, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethyl-N,N-bis(sulfanyl)tridecanethioamide is sourced from PubChem (CID 175163946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).