C32H32O3 — CID 175171881
[4-[1,2-bis(4-methoxyphenyl)-2-(2-propan-2-ylphenyl)ethenyl]phenyl]methanol (PubChem CID 175171881) has the molecular formula C32H32O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is [4-[1,2-bis(4-methoxyphenyl)-2-(2-propan-2-ylphenyl)ethenyl]phenyl]methanol.
| Compound Name | [4-[1,2-bis(4-methoxyphenyl)-2-(2-propan-2-ylphenyl)ethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 175171881 |
| Molecular Formula | C32H32O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | [4-[1,2-bis(4-methoxyphenyl)-2-(2-propan-2-ylphenyl)ethenyl]phenyl]methanol |
| SMILES | COc1ccc(C(=C(c2ccc(OC)cc2)c2ccccc2C(C)C)c2ccc(CO)cc2)cc1 |
| InChI | InChI=1S/C32H32O3/c1-22(2)29-7-5-6-8-30(29)32(26-15-19-28(35-4)20-16-26)31(24-11-9-23(21-33)10-12-24)25-13-17-27(34-3)18-14-25/h5-20,22,33H,21H2,1-4H3 |
| InChIKey | RYICUYDKWXETIZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|