C37H34O2 — CID 175180750
1-[1,2-bis(4-methoxyphenyl)-2-(4-phenylphenyl)ethenyl]-2-propan-2-ylbenzene (PubChem CID 175180750) has the molecular formula C37H34O2 and a molecular weight of 510.68 g/mol. Its IUPAC name is 1-[1,2-bis(4-methoxyphenyl)-2-(4-phenylphenyl)ethenyl]-2-propan-2-ylbenzene.
| Compound Name | 1-[1,2-bis(4-methoxyphenyl)-2-(4-phenylphenyl)ethenyl]-2-propan-2-ylbenzene |
|---|---|
| PubChem CID | 175180750 |
| Molecular Formula | C37H34O2 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 1-[1,2-bis(4-methoxyphenyl)-2-(4-phenylphenyl)ethenyl]-2-propan-2-ylbenzene |
| SMILES | COc1ccc(C(=C(c2ccc(OC)cc2)c2ccccc2C(C)C)c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C37H34O2/c1-26(2)34-12-8-9-13-35(34)37(31-20-24-33(39-4)25-21-31)36(30-18-22-32(38-3)23-19-30)29-16-14-28(15-17-29)27-10-6-5-7-11-27/h5-26H,1-4H3 |
| InChIKey | LGZATANSUADCJV-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|