C28H27O3P — CID 175173329
[diphenyl-(3,4,5-trimethoxy-2-phenylphenyl)methyl]phosphane (PubChem CID 175173329) has the molecular formula C28H27O3P and a molecular weight of 442.50 g/mol. Its IUPAC name is [diphenyl-(3,4,5-trimethoxy-2-phenylphenyl)methyl]phosphane.
| Compound Name | [diphenyl-(3,4,5-trimethoxy-2-phenylphenyl)methyl]phosphane |
|---|---|
| PubChem CID | 175173329 |
| Molecular Formula | C28H27O3P |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | [diphenyl-(3,4,5-trimethoxy-2-phenylphenyl)methyl]phosphane |
| SMILES | COc1cc(C(P)(c2ccccc2)c2ccccc2)c(-c2ccccc2)c(OC)c1OC |
| InChI | InChI=1S/C28H27O3P/c1-29-24-19-23(25(20-13-7-4-8-14-20)27(31-3)26(24)30-2)28(32,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-19H,32H2,1-3H3 |
| InChIKey | PFGPKEGCOFOBKH-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|