C28H21ClN8O5 — CID 175176861
N-(2-amino-4-nitrophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-3-phenylprop-2-enamide (PubChem CID 175176861) has the molecular formula C28H21ClN8O5 and a molecular weight of 584.98 g/mol. Its IUPAC name is N-(2-amino-4-nitrophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-3-phenylprop-2-enamide.
| Compound Name | N-(2-amino-4-nitrophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 175176861 |
| Molecular Formula | C28H21ClN8O5 |
| Molecular Weight | 584.98 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | N-(2-amino-4-nitrophenyl)-2-[4-[5-chloro-2-(tetrazol-1-yl)phenyl]-5-methoxy-2-oxo-1-pyridinyl]-3-phenylprop-2-enamide |
| SMILES | COc1cn(C(=Cc2ccccc2)C(=O)Nc2ccc([N+](=O)[O-])cc2N)c(=O)cc1-c1cc(Cl)ccc1-n1cnnn1 |
| InChI | InChI=1S/C28H21ClN8O5/c1-42-26-15-35(27(38)14-21(26)20-12-18(29)7-10-24(20)36-16-31-33-34-36)25(11-17-5-3-2-4-6-17)28(39)32-23-9-8-19(37(40)41)13-22(23)30/h2-16H,30H2,1H3,(H,32,39) |
| InChIKey | KSCZPQRRAZGDEL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 173.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|