C19H20ClN7O2 — CID 175181871
N-[4-(6-amino-5-methoxyindazol-1-yl)butan-2-yl]-6-chloroimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 175181871) has the molecular formula C19H20ClN7O2 and a molecular weight of 413.87 g/mol. Its IUPAC name is N-[4-(6-amino-5-methoxyindazol-1-yl)butan-2-yl]-6-chloroimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | N-[4-(6-amino-5-methoxyindazol-1-yl)butan-2-yl]-6-chloroimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 175181871 |
| Molecular Formula | C19H20ClN7O2 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[4-(6-amino-5-methoxyindazol-1-yl)butan-2-yl]-6-chloroimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | COc1cc2cnn(CCC(C)NC(=O)c3cnc4ccc(Cl)nn34)c2cc1N |
| InChI | InChI=1S/C19H20ClN7O2/c1-11(24-19(28)15-10-22-18-4-3-17(20)25-27(15)18)5-6-26-14-8-13(21)16(29-2)7-12(14)9-23-26/h3-4,7-11H,5-6,21H2,1-2H3,(H,24,28) |
| InChIKey | HURQFTIWYDYXQA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|