About 4-methylheptylboronic acid
4-methylheptylboronic acid (PubChem CID 175182687) has the molecular formula C8H19BO2
and a molecular weight of 158.05 g/mol. Its IUPAC name is 4-methylheptylboronic acid.
Molecular Properties
| Compound Name | 4-methylheptylboronic acid |
| PubChem CID | 175182687 |
| Molecular Formula | C8H19BO2 |
| Molecular Weight | 158.05 g/mol |
| Exact Mass | 158.15 |
| IUPAC Name | 4-methylheptylboronic acid |
| SMILES | CCCC(C)CCCB(O)O |
| InChI | InChI=1S/C8H19BO2/c1-3-5-8(2)6-4-7-9(10)11/h8,10-11H,3-7H2,1-2H3 |
| InChIKey | IDIVOAGJHNBOCV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.05 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptylboronic acid?
The IUPAC name of 4-methylheptylboronic acid (CID 175182687) is 4-methylheptylboronic acid.
What is the SMILES notation for 4-methylheptylboronic acid?
The canonical SMILES for 4-methylheptylboronic acid is CCCC(C)CCCB(O)O.
What is the InChIKey of 4-methylheptylboronic acid?
The InChIKey is IDIVOAGJHNBOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19BO2/c1-3-5-8(2)6-4-7-9(10)11/h8,10-11H,3-7H2,1-2H3.
What are the key properties of 4-methylheptylboronic acid?
4-methylheptylboronic acid has a molecular weight of 158.05 g/mol, XLogP of 1.68, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptylboronic acid is sourced from PubChem (CID 175182687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).