About [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate
[5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate (PubChem CID 175185055) has the molecular formula C16H13F3N4O4S2
and a molecular weight of 446.43 g/mol. Its IUPAC name is [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate.
Molecular Properties
| Compound Name | [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate |
| PubChem CID | 175185055 |
| Molecular Formula | C16H13F3N4O4S2 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate |
| SMILES | Cn1cc(-c2cc(C(F)(F)F)cc(S(=O)(=O)c3cnc(COC(N)=O)s3)c2)cn1 |
| InChI | InChI=1S/C16H13F3N4O4S2/c1-23-7-10(5-22-23)9-2-11(16(17,18)19)4-12(3-9)29(25,26)14-6-21-13(28-14)8-27-15(20)24/h2-7H,8H2,1H3,(H2,20,24) |
| InChIKey | RDGHVEYBOFRCSG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate?
The IUPAC name of [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate (CID 175185055) is [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate.
What is the SMILES notation for [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate?
The canonical SMILES for [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate is Cn1cc(-c2cc(C(F)(F)F)cc(S(=O)(=O)c3cnc(COC(N)=O)s3)c2)cn1.
What is the InChIKey of [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate?
The InChIKey is RDGHVEYBOFRCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3N4O4S2/c1-23-7-10(5-22-23)9-2-11(16(17,18)19)4-12(3-9)29(25,26)14-6-21-13(28-14)8-27-15(20)24/h2-7H,8H2,1H3,(H2,20,24).
What are the key properties of [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate?
[5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate has a molecular weight of 446.43 g/mol, XLogP of 2.99, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-(1-methylpyrazol-4-yl)-5-(trifluoromethyl)phenyl]sulfonyl-1,3-thiazol-2-yl]methyl carbamate is sourced from PubChem (CID 175185055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).