C16H11BrF6N2O2 — CID 156695941
ethyl (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]-2-bromoprop-2-enoate (PubChem CID 156695941) has the molecular formula C16H11BrF6N2O2 and a molecular weight of 457.17 g/mol. Its IUPAC name is ethyl (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]-2-bromoprop-2-enoate.
| Compound Name | ethyl (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]-2-bromoprop-2-enoate |
|---|---|
| PubChem CID | 156695941 |
| Molecular Formula | C16H11BrF6N2O2 |
| Molecular Weight | 457.17 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | ethyl (Z)-3-[4-[3,5-bis(trifluoromethyl)phenyl]pyrazol-1-yl]-2-bromoprop-2-enoate |
| SMILES | CCOC(=O)/C(Br)=C/n1cc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C16H11BrF6N2O2/c1-2-27-14(26)13(17)8-25-7-10(6-24-25)9-3-11(15(18,19)20)5-12(4-9)16(21,22)23/h3-8H,2H2,1H3/b13-8- |
| InChIKey | TXUUOVKCVOZMDY-JYRVWZFOSA-N |
| XLogP | 5.34 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.17 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|