C18H18N2O2 — CID 175185198
[(3-methylphenyl)methylideneamino] 3,4-dihydro-2H-quinoline-1-carboxylate (PubChem CID 175185198) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is [(3-methylphenyl)methylideneamino] 3,4-dihydro-2H-quinoline-1-carboxylate.
| Compound Name | [(3-methylphenyl)methylideneamino] 3,4-dihydro-2H-quinoline-1-carboxylate |
|---|---|
| PubChem CID | 175185198 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | [(3-methylphenyl)methylideneamino] 3,4-dihydro-2H-quinoline-1-carboxylate |
| SMILES | Cc1cccc(C=NOC(=O)N2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C18H18N2O2/c1-14-6-4-7-15(12-14)13-19-22-18(21)20-11-5-9-16-8-2-3-10-17(16)20/h2-4,6-8,10,12-13H,5,9,11H2,1H3 |
| InChIKey | ZPARZPWPTVBJED-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|