C22H38O7 — CID 175185718
bis(3-acetyl-3,4,4-trimethylhexane-2,5-dione);hydrate (PubChem CID 175185718) has the molecular formula C22H38O7 and a molecular weight of 414.54 g/mol. Its IUPAC name is bis(3-acetyl-3,4,4-trimethylhexane-2,5-dione);hydrate.
| Compound Name | bis(3-acetyl-3,4,4-trimethylhexane-2,5-dione);hydrate |
|---|---|
| PubChem CID | 175185718 |
| Molecular Formula | C22H38O7 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | bis(3-acetyl-3,4,4-trimethylhexane-2,5-dione);hydrate |
| SMILES | CC(=O)C(C)(C)C(C)(C(C)=O)C(C)=O.CC(=O)C(C)(C)C(C)(C(C)=O)C(C)=O.O |
| InChI | InChI=1S/2C11H18O3.H2O/c2*1-7(12)10(4,5)11(6,8(2)13)9(3)14;/h2*1-6H3;1H2 |
| InChIKey | DVXUABQDGFWCLD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 133.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|