C20H28N2O6 — CID 175188540
2-[[(4aR,10aR)-1-ethyl-6-(methoxymethoxy)-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl]oxycarbonylamino]acetic acid (PubChem CID 175188540) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is 2-[[(4aR,10aR)-1-ethyl-6-(methoxymethoxy)-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl]oxycarbonylamino]acetic acid.
| Compound Name | 2-[[(4aR,10aR)-1-ethyl-6-(methoxymethoxy)-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl]oxycarbonylamino]acetic acid |
|---|---|
| PubChem CID | 175188540 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 2-[[(4aR,10aR)-1-ethyl-6-(methoxymethoxy)-3,4,4a,5,10,10a-hexahydro-2H-benzo[g]quinolin-7-yl]oxycarbonylamino]acetic acid |
| SMILES | CCN1CCC[C@@H]2Cc3c(ccc(OC(=O)NCC(=O)O)c3OCOC)C[C@H]21 |
| InChI | InChI=1S/C20H28N2O6/c1-3-22-8-4-5-14-9-15-13(10-16(14)22)6-7-17(19(15)27-12-26-2)28-20(25)21-11-18(23)24/h6-7,14,16H,3-5,8-12H2,1-2H3,(H,21,25)(H,23,24)/t14-,16-/m1/s1 |
| InChIKey | QGOPVVBGEKHQFP-GDBMZVCRSA-N |
| XLogP | 2.04 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|