C14H16F2O3 — CID 175190331
2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid (PubChem CID 175190331) has the molecular formula C14H16F2O3 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid.
| Compound Name | 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid |
|---|---|
| PubChem CID | 175190331 |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid |
| SMILES | C=Cc1ccc(OC(C)C(=O)O)c(C(F)(F)CC)c1 |
| InChI | InChI=1S/C14H16F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h4,6-9H,1,5H2,2-3H3,(H,17,18) |
| InChIKey | HEDDBQJNDGAZQT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |