2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid

C14H16F2O3 — CID 175190331

IUPAC2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid
SMILESC=Cc1ccc(OC(C)C(=O)O)c(C(F)(F)CC)c1
InChIInChI=1S/C14H16F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h4,6-9H,1,5H2,2-3H3,(H,17,18)
InChIKeyHEDDBQJNDGAZQT-UHFFFAOYSA-N
MW270.28 g/mol
LogP3.68
Rot. Bonds6

About 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid

2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid (PubChem CID 175190331) has the molecular formula C14H16F2O3 and a molecular weight of 270.28 g/mol. Its IUPAC name is 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid.

Molecular Properties

Compound Name2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid
PubChem CID175190331
Molecular FormulaC14H16F2O3
Molecular Weight270.28 g/mol
Exact Mass270.11
IUPAC Name2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid
SMILESC=Cc1ccc(OC(C)C(=O)O)c(C(F)(F)CC)c1
InChIInChI=1S/C14H16F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h4,6-9H,1,5H2,2-3H3,(H,17,18)
InChIKeyHEDDBQJNDGAZQT-UHFFFAOYSA-N
XLogP3.68
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.28
LogP ≤ 53.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid?
The IUPAC name of 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid (CID 175190331) is 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid.
What is the SMILES notation for 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid?
The canonical SMILES for 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid is C=Cc1ccc(OC(C)C(=O)O)c(C(F)(F)CC)c1.
What is the InChIKey of 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid?
The InChIKey is HEDDBQJNDGAZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h4,6-9H,1,5H2,2-3H3,(H,17,18).
What are the key properties of 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid?
2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid has a molecular weight of 270.28 g/mol, XLogP of 3.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,1-difluoropropyl)-4-ethenylphenoxy]propanoic acid is sourced from PubChem (CID 175190331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).