C14H16F3NO3 — CID 166048940
amino (2S)-2-[2-(1,1-difluoropropyl)-4-ethenyl-5-fluorophenoxy]propanoate (PubChem CID 166048940) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is amino (2S)-2-[2-(1,1-difluoropropyl)-4-ethenyl-5-fluorophenoxy]propanoate.
| Compound Name | amino (2S)-2-[2-(1,1-difluoropropyl)-4-ethenyl-5-fluorophenoxy]propanoate |
|---|---|
| PubChem CID | 166048940 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | amino (2S)-2-[2-(1,1-difluoropropyl)-4-ethenyl-5-fluorophenoxy]propanoate |
| SMILES | C=Cc1cc(C(F)(F)CC)c(O[C@@H](C)C(=O)ON)cc1F |
| InChI | InChI=1S/C14H16F3NO3/c1-4-9-6-10(14(16,17)5-2)12(7-11(9)15)20-8(3)13(19)21-18/h4,6-8H,1,5,18H2,2-3H3/t8-/m0/s1 |
| InChIKey | LYNLOYIPLYKVGZ-QMMMGPOBSA-N |
| XLogP | 3.15 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|