(2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid

C14H14F2O3 — CID 155744400

IUPAC(2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid
SMILESC#Cc1ccc(O[C@@H](C)C(=O)O)c(C(F)(F)CC)c1
InChIInChI=1S/C14H14F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h1,6-9H,5H2,2-3H3,(H,17,18)/t9-/m0/s1
InChIKeyHIGMZZCQUKJKHD-VIFPVBQESA-N
MW268.26 g/mol
LogP3.02
Rot. Bonds5

About (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid

(2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid (PubChem CID 155744400) has the molecular formula C14H14F2O3 and a molecular weight of 268.26 g/mol. Its IUPAC name is (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid.

Molecular Properties

Compound Name(2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid
PubChem CID155744400
Molecular FormulaC14H14F2O3
Molecular Weight268.26 g/mol
Exact Mass268.09
IUPAC Name(2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid
SMILESC#Cc1ccc(O[C@@H](C)C(=O)O)c(C(F)(F)CC)c1
InChIInChI=1S/C14H14F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h1,6-9H,5H2,2-3H3,(H,17,18)/t9-/m0/s1
InChIKeyHIGMZZCQUKJKHD-VIFPVBQESA-N
XLogP3.02
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.26
LogP ≤ 53.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid?
The IUPAC name of (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid (CID 155744400) is (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid.
What is the SMILES notation for (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid?
The canonical SMILES for (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid is C#Cc1ccc(O[C@@H](C)C(=O)O)c(C(F)(F)CC)c1.
What is the InChIKey of (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid?
The InChIKey is HIGMZZCQUKJKHD-VIFPVBQESA-N. The full InChI is InChI=1S/C14H14F2O3/c1-4-10-6-7-12(19-9(3)13(17)18)11(8-10)14(15,16)5-2/h1,6-9H,5H2,2-3H3,(H,17,18)/t9-/m0/s1.
What are the key properties of (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid?
(2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid has a molecular weight of 268.26 g/mol, XLogP of 3.02, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2-(1,1-difluoropropyl)-4-ethynylphenoxy]propanoic acid is sourced from PubChem (CID 155744400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).