C13H12BrF3N2O2 — CID 155413766
(2S)-2-[4-bromo-2-(1,1-difluoropropyl)-5-fluorophenoxy]-N-cyanopropanamide (PubChem CID 155413766) has the molecular formula C13H12BrF3N2O2 and a molecular weight of 365.15 g/mol. Its IUPAC name is (2S)-2-[4-bromo-2-(1,1-difluoropropyl)-5-fluorophenoxy]-N-cyanopropanamide.
| Compound Name | (2S)-2-[4-bromo-2-(1,1-difluoropropyl)-5-fluorophenoxy]-N-cyanopropanamide |
|---|---|
| PubChem CID | 155413766 |
| Molecular Formula | C13H12BrF3N2O2 |
| Molecular Weight | 365.15 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | (2S)-2-[4-bromo-2-(1,1-difluoropropyl)-5-fluorophenoxy]-N-cyanopropanamide |
| SMILES | CCC(F)(F)c1cc(Br)c(F)cc1O[C@@H](C)C(=O)NC#N |
| InChI | InChI=1S/C13H12BrF3N2O2/c1-3-13(16,17)8-4-9(14)10(15)5-11(8)21-7(2)12(20)19-6-18/h4-5,7H,3H2,1-2H3,(H,19,20)/t7-/m0/s1 |
| InChIKey | JHMSWTLXQAHIKF-ZETCQYMHSA-N |
| XLogP | 3.45 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|