C17H30N2O4 — CID 175192933
2-[hex-3-ynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propanoic acid (PubChem CID 175192933) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[hex-3-ynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propanoic acid.
| Compound Name | 2-[hex-3-ynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175192933 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-[hex-3-ynyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]amino]propanoic acid |
| SMILES | CCC#CCCN(CC(C)NC(=O)OC(C)(C)C)C(C)C(=O)O |
| InChI | InChI=1S/C17H30N2O4/c1-7-8-9-10-11-19(14(3)15(20)21)12-13(2)18-16(22)23-17(4,5)6/h13-14H,7,10-12H2,1-6H3,(H,18,22)(H,20,21) |
| InChIKey | KWRQJYNENYKBKI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|