C7H6FNO3 — CID 175193181
3-fluoro-6-nitrobicyclo[3.1.1]hepta-1,3,5-triene;hydrate (PubChem CID 175193181) has the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. Its IUPAC name is 3-fluoro-6-nitrobicyclo[3.1.1]hepta-1,3,5-triene;hydrate.
| Compound Name | 3-fluoro-6-nitrobicyclo[3.1.1]hepta-1,3,5-triene;hydrate |
|---|---|
| PubChem CID | 175193181 |
| Molecular Formula | C7H6FNO3 |
| Molecular Weight | 171.13 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 3-fluoro-6-nitrobicyclo[3.1.1]hepta-1,3,5-triene;hydrate |
| SMILES | O.O=[N+]([O-])c1c2cc(F)cc1C2 |
| InChI | InChI=1S/C7H4FNO2.H2O/c8-6-2-4-1-5(3-6)7(4)9(10)11;/h2-3H,1H2;1H2 |
| InChIKey | RVXIQGPJGVYFEX-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 74.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.13 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|