C24H42O7 — CID 175195129
[(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 175195129) has the molecular formula C24H42O7 and a molecular weight of 442.59 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | [(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 175195129 |
| Molecular Formula | C24H42O7 |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | [(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O[C@@]1(O)CO[C@@H]2[C@H](O)CO[C@@H]21 |
| InChI | InChI=1S/C24H42O7/c1-2-3-4-11-14-19(25)15-12-9-7-5-6-8-10-13-16-21(27)31-24(28)18-30-22-20(26)17-29-23(22)24/h9,12,19-20,22-23,25-26,28H,2-8,10-11,13-18H2,1H3/b12-9-/t19-,20-,22-,23+,24+/m1/s1 |
| InChIKey | JTCQJPBSUVHADF-MOIWIYLUSA-N |
| XLogP | 3.38 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|