C14H17BrF2N2O2 — CID 175196185
[1-[1-(4-bromo-2,5-difluorophenyl)azetidin-3-yl]-2-methylpropan-2-yl]carbamic acid (PubChem CID 175196185) has the molecular formula C14H17BrF2N2O2 and a molecular weight of 363.20 g/mol. Its IUPAC name is [1-[1-(4-bromo-2,5-difluorophenyl)azetidin-3-yl]-2-methylpropan-2-yl]carbamic acid.
| Compound Name | [1-[1-(4-bromo-2,5-difluorophenyl)azetidin-3-yl]-2-methylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175196185 |
| Molecular Formula | C14H17BrF2N2O2 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | [1-[1-(4-bromo-2,5-difluorophenyl)azetidin-3-yl]-2-methylpropan-2-yl]carbamic acid |
| SMILES | CC(C)(CC1CN(c2cc(F)c(Br)cc2F)C1)NC(=O)O |
| InChI | InChI=1S/C14H17BrF2N2O2/c1-14(2,18-13(20)21)5-8-6-19(7-8)12-4-10(16)9(15)3-11(12)17/h3-4,8,18H,5-7H2,1-2H3,(H,20,21) |
| InChIKey | XBCAPDSGVIGUOL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|