About hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride
hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride (PubChem CID 175196322) has the molecular formula C8H18ClNO+2
and a molecular weight of 179.69 g/mol. Its IUPAC name is hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride.
Molecular Properties
| Compound Name | hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride |
| PubChem CID | 175196322 |
| Molecular Formula | C8H18ClNO+2 |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride |
| SMILES | C=CC(=O)CC[N+](C)(C)C.Cl.[H+] |
| InChI | InChI=1S/C8H16NO.ClH/c1-5-8(10)6-7-9(2,3)4;/h5H,1,6-7H2,2-4H3;1H/q+1;/p+1 |
| InChIKey | ICKIMNNCJKMGAT-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride?
The IUPAC name of hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride (CID 175196322) is hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride.
What is the SMILES notation for hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride?
The canonical SMILES for hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride is C=CC(=O)CC[N+](C)(C)C.Cl.[H+].
What is the InChIKey of hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride?
The InChIKey is ICKIMNNCJKMGAT-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H16NO.ClH/c1-5-8(10)6-7-9(2,3)4;/h5H,1,6-7H2,2-4H3;1H/q+1;/p+1.
What are the key properties of hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride?
hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride has a molecular weight of 179.69 g/mol, XLogP of 1.37, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;trimethyl(3-oxopent-4-enyl)azanium;hydrochloride is sourced from PubChem (CID 175196322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).