C8H16NO5P — CID 172840022
[dimethyl(3-oxopent-4-enyl)azaniumyl]methyl hydrogen phosphate (PubChem CID 172840022) has the molecular formula C8H16NO5P and a molecular weight of 237.19 g/mol. Its IUPAC name is [dimethyl(3-oxopent-4-enyl)azaniumyl]methyl hydrogen phosphate.
| Compound Name | [dimethyl(3-oxopent-4-enyl)azaniumyl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 172840022 |
| Molecular Formula | C8H16NO5P |
| Molecular Weight | 237.19 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | [dimethyl(3-oxopent-4-enyl)azaniumyl]methyl hydrogen phosphate |
| SMILES | C=CC(=O)CC[N+](C)(C)COP(=O)([O-])O |
| InChI | InChI=1S/C8H16NO5P/c1-4-8(10)5-6-9(2,3)7-14-15(11,12)13/h4H,1,5-7H2,2-3H3,(H-,11,12,13) |
| InChIKey | WRAHAPJELBGFTL-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.19 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|