C8H24N2Si2 — CID 175201486
1-N-[2-[dimethylsilyl(methyl)silyl]ethyl]propane-1,2-diamine (PubChem CID 175201486) has the molecular formula C8H24N2Si2 and a molecular weight of 204.47 g/mol. Its IUPAC name is 1-N-[2-[dimethylsilyl(methyl)silyl]ethyl]propane-1,2-diamine.
| Compound Name | 1-N-[2-[dimethylsilyl(methyl)silyl]ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 175201486 |
| Molecular Formula | C8H24N2Si2 |
| Molecular Weight | 204.47 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 1-N-[2-[dimethylsilyl(methyl)silyl]ethyl]propane-1,2-diamine |
| SMILES | CC(N)CNCC[SiH](C)[SiH](C)C |
| InChI | InChI=1S/C8H24N2Si2/c1-8(9)7-10-5-6-12(4)11(2)3/h8,10-12H,5-7,9H2,1-4H3 |
| InChIKey | HMMVSCPRCDZLQU-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.47 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|