C13H24BrNO6 — CID 175201777
6-bromo-5,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 175201777) has the molecular formula C13H24BrNO6 and a molecular weight of 370.24 g/mol. Its IUPAC name is 6-bromo-5,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 6-bromo-5,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 175201777 |
| Molecular Formula | C13H24BrNO6 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 6-bromo-5,5-dimethoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | COC(CBr)(CCC(NC(=O)OC(C)(C)C)C(=O)O)OC |
| InChI | InChI=1S/C13H24BrNO6/c1-12(2,3)21-11(18)15-9(10(16)17)6-7-13(8-14,19-4)20-5/h9H,6-8H2,1-5H3,(H,15,18)(H,16,17) |
| InChIKey | FJWZFIVHFQQSGL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|