C18H13F3N2O6S — CID 175210159
4-[2-[1-oxo-4-(trifluoromethylsulfonyloxy)phthalazin-2-yl]ethyl]benzoic acid (PubChem CID 175210159) has the molecular formula C18H13F3N2O6S and a molecular weight of 442.37 g/mol. Its IUPAC name is 4-[2-[1-oxo-4-(trifluoromethylsulfonyloxy)phthalazin-2-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[1-oxo-4-(trifluoromethylsulfonyloxy)phthalazin-2-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175210159 |
| Molecular Formula | C18H13F3N2O6S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 4-[2-[1-oxo-4-(trifluoromethylsulfonyloxy)phthalazin-2-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCn2nc(OS(=O)(=O)C(F)(F)F)c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C18H13F3N2O6S/c19-18(20,21)30(27,28)29-15-13-3-1-2-4-14(13)16(24)23(22-15)10-9-11-5-7-12(8-6-11)17(25)26/h1-8H,9-10H2,(H,25,26) |
| InChIKey | GBZMLZFENCYSBN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|