C19H16F3N3O5S — CID 88924897
3-[methyl(2-phenylethyl)amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylic acid (PubChem CID 88924897) has the molecular formula C19H16F3N3O5S and a molecular weight of 455.41 g/mol. Its IUPAC name is 3-[methyl(2-phenylethyl)amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylic acid.
| Compound Name | 3-[methyl(2-phenylethyl)amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylic acid |
|---|---|
| PubChem CID | 88924897 |
| Molecular Formula | C19H16F3N3O5S |
| Molecular Weight | 455.41 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 3-[methyl(2-phenylethyl)amino]-2-(trifluoromethylsulfonyloxy)quinoxaline-6-carboxylic acid |
| SMILES | CN(CCc1ccccc1)c1nc2cc(C(=O)O)ccc2nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C19H16F3N3O5S/c1-25(10-9-12-5-3-2-4-6-12)16-17(30-31(28,29)19(20,21)22)24-14-8-7-13(18(26)27)11-15(14)23-16/h2-8,11H,9-10H2,1H3,(H,26,27) |
| InChIKey | KFIWCMFCFDRHJL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 109.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|