About 3-fluoropropyl N-sulfonylcarbamate
3-fluoropropyl N-sulfonylcarbamate (PubChem CID 175211437) has the molecular formula C4H6FNO4S
and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-fluoropropyl N-sulfonylcarbamate.
Molecular Properties
| Compound Name | 3-fluoropropyl N-sulfonylcarbamate |
| PubChem CID | 175211437 |
| Molecular Formula | C4H6FNO4S |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 3-fluoropropyl N-sulfonylcarbamate |
| SMILES | O=C(N=S(=O)=O)OCCCF |
| InChI | InChI=1S/C4H6FNO4S/c5-2-1-3-10-4(7)6-11(8)9/h1-3H2 |
| InChIKey | AGULFJKQUNNWLT-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoropropyl N-sulfonylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoropropyl N-sulfonylcarbamate?
The IUPAC name of 3-fluoropropyl N-sulfonylcarbamate (CID 175211437) is 3-fluoropropyl N-sulfonylcarbamate.
What is the SMILES notation for 3-fluoropropyl N-sulfonylcarbamate?
The canonical SMILES for 3-fluoropropyl N-sulfonylcarbamate is O=C(N=S(=O)=O)OCCCF.
What is the InChIKey of 3-fluoropropyl N-sulfonylcarbamate?
The InChIKey is AGULFJKQUNNWLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6FNO4S/c5-2-1-3-10-4(7)6-11(8)9/h1-3H2.
What are the key properties of 3-fluoropropyl N-sulfonylcarbamate?
3-fluoropropyl N-sulfonylcarbamate has a molecular weight of 183.16 g/mol, XLogP of 0.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoropropyl N-sulfonylcarbamate is sourced from PubChem (CID 175211437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).