About 10-fluorodecyl 2-phosphanyloxyacetate
10-fluorodecyl 2-phosphanyloxyacetate (PubChem CID 19783933) has the molecular formula C12H24FO3P
and a molecular weight of 266.29 g/mol. Its IUPAC name is 10-fluorodecyl 2-phosphanyloxyacetate.
Molecular Properties
| Compound Name | 10-fluorodecyl 2-phosphanyloxyacetate |
| PubChem CID | 19783933 |
| Molecular Formula | C12H24FO3P |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 10-fluorodecyl 2-phosphanyloxyacetate |
| SMILES | O=C(COP)OCCCCCCCCCCF |
| InChI | InChI=1S/C12H24FO3P/c13-9-7-5-3-1-2-4-6-8-10-15-12(14)11-16-17/h1-11,17H2 |
| InChIKey | VAOPUSOMEOBXAA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 10-fluorodecyl 2-phosphanyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-fluorodecyl 2-phosphanyloxyacetate?
The IUPAC name of 10-fluorodecyl 2-phosphanyloxyacetate (CID 19783933) is 10-fluorodecyl 2-phosphanyloxyacetate.
What is the SMILES notation for 10-fluorodecyl 2-phosphanyloxyacetate?
The canonical SMILES for 10-fluorodecyl 2-phosphanyloxyacetate is O=C(COP)OCCCCCCCCCCF.
What is the InChIKey of 10-fluorodecyl 2-phosphanyloxyacetate?
The InChIKey is VAOPUSOMEOBXAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24FO3P/c13-9-7-5-3-1-2-4-6-8-10-15-12(14)11-16-17/h1-11,17H2.
What are the key properties of 10-fluorodecyl 2-phosphanyloxyacetate?
10-fluorodecyl 2-phosphanyloxyacetate has a molecular weight of 266.29 g/mol, XLogP of 3.43, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-fluorodecyl 2-phosphanyloxyacetate is sourced from PubChem (CID 19783933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).