C17H20N4O5S — CID 175211517
pyrrolidin-3-yl [6-(phenylmethoxycarbonylamino)pyridazin-3-yl]methanesulfonate (PubChem CID 175211517) has the molecular formula C17H20N4O5S and a molecular weight of 392.44 g/mol. Its IUPAC name is pyrrolidin-3-yl [6-(phenylmethoxycarbonylamino)pyridazin-3-yl]methanesulfonate.
| Compound Name | pyrrolidin-3-yl [6-(phenylmethoxycarbonylamino)pyridazin-3-yl]methanesulfonate |
|---|---|
| PubChem CID | 175211517 |
| Molecular Formula | C17H20N4O5S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | pyrrolidin-3-yl [6-(phenylmethoxycarbonylamino)pyridazin-3-yl]methanesulfonate |
| SMILES | O=C(Nc1ccc(CS(=O)(=O)OC2CCNC2)nn1)OCc1ccccc1 |
| InChI | InChI=1S/C17H20N4O5S/c22-17(25-11-13-4-2-1-3-5-13)19-16-7-6-14(20-21-16)12-27(23,24)26-15-8-9-18-10-15/h1-7,15,18H,8-12H2,(H,19,21,22) |
| InChIKey | ZNDAFNKINYHPEM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|