About 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate
4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate (PubChem CID 175212946) has the molecular formula C14H10CeN3O13
and a molecular weight of 568.36 g/mol. Its IUPAC name is 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate.
Molecular Properties
| Compound Name | 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate |
| PubChem CID | 175212946 |
| Molecular Formula | C14H10CeN3O13 |
| Molecular Weight | 568.36 g/mol |
| Exact Mass | 567.93 |
| IUPAC Name | 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate |
| SMILES | O=C(O)c1ccc(-c2ccc(C(=O)O)cc2)cc1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Ce+3] |
| InChI | InChI=1S/C14H10O4.Ce.3NO3/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18;;3*2-1(3)4/h1-8H,(H,15,16)(H,17,18);;;;/q;+3;3*-1 |
| InChIKey | SBRDGKSKNVAEFB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 273.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate?
The IUPAC name of 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate (CID 175212946) is 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate.
What is the SMILES notation for 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate?
The canonical SMILES for 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate is O=C(O)c1ccc(-c2ccc(C(=O)O)cc2)cc1.O=[N+]([O-])[O-].O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Ce+3].
What is the InChIKey of 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate?
The InChIKey is SBRDGKSKNVAEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4.Ce.3NO3/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18;;3*2-1(3)4/h1-8H,(H,15,16)(H,17,18);;;;/q;+3;3*-1.
What are the key properties of 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate?
4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate has a molecular weight of 568.36 g/mol, XLogP of 2.03, 3 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-carboxyphenyl)benzoic acid;cerium(3+);trinitrate is sourced from PubChem (CID 175212946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).