C18H25I2N5O2 — CID 175216255
tert-butyl 4,4-bis(2-iodo-1-methylimidazol-4-yl)piperidine-1-carboxylate (PubChem CID 175216255) has the molecular formula C18H25I2N5O2 and a molecular weight of 597.24 g/mol. Its IUPAC name is tert-butyl 4,4-bis(2-iodo-1-methylimidazol-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-bis(2-iodo-1-methylimidazol-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175216255 |
| Molecular Formula | C18H25I2N5O2 |
| Molecular Weight | 597.24 g/mol |
| Exact Mass | 597.01 |
| IUPAC Name | tert-butyl 4,4-bis(2-iodo-1-methylimidazol-4-yl)piperidine-1-carboxylate |
| SMILES | Cn1cc(C2(c3cn(C)c(I)n3)CCN(C(=O)OC(C)(C)C)CC2)nc1I |
| InChI | InChI=1S/C18H25I2N5O2/c1-17(2,3)27-16(26)25-8-6-18(7-9-25,12-10-23(4)14(19)21-12)13-11-24(5)15(20)22-13/h10-11H,6-9H2,1-5H3 |
| InChIKey | GRFMGFZPKDUBIA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 65.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|