C23H30N4O4S — CID 175217579
2-[(3,4-dimethoxyphenyl)methyl]-4-[(5-pentyl-1H-pyrazol-4-yl)amino]benzenesulfonamide (PubChem CID 175217579) has the molecular formula C23H30N4O4S and a molecular weight of 458.58 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-4-[(5-pentyl-1H-pyrazol-4-yl)amino]benzenesulfonamide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[(5-pentyl-1H-pyrazol-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 175217579 |
| Molecular Formula | C23H30N4O4S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-4-[(5-pentyl-1H-pyrazol-4-yl)amino]benzenesulfonamide |
| SMILES | CCCCCc1[nH]ncc1Nc1ccc(S(N)(=O)=O)c(Cc2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C23H30N4O4S/c1-4-5-6-7-19-20(15-25-27-19)26-18-9-11-23(32(24,28)29)17(14-18)12-16-8-10-21(30-2)22(13-16)31-3/h8-11,13-15,26H,4-7,12H2,1-3H3,(H,25,27)(H2,24,28,29) |
| InChIKey | CMJRFBFVLBRXHY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|