C9H19ClN2 — CID 175222126
3-methyl-1-pentyl-1,2-dihydroimidazol-1-ium chloride (PubChem CID 175222126) has the molecular formula C9H19ClN2 and a molecular weight of 190.72 g/mol. Its IUPAC name is 3-methyl-1-pentyl-1,2-dihydroimidazol-1-ium chloride.
| Compound Name | 3-methyl-1-pentyl-1,2-dihydroimidazol-1-ium chloride |
|---|---|
| PubChem CID | 175222126 |
| Molecular Formula | C9H19ClN2 |
| Molecular Weight | 190.72 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 3-methyl-1-pentyl-1,2-dihydroimidazol-1-ium chloride |
| SMILES | CCCCC[NH+]1C=CN(C)C1.[Cl-] |
| InChI | InChI=1S/C9H18N2.ClH/c1-3-4-5-6-11-8-7-10(2)9-11;/h7-8H,3-6,9H2,1-2H3;1H |
| InChIKey | DMWWIDHGDVRHMP-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.72 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|