C22H45BrN2 — CID 71394755
1-hexadecyl-3-propyl-1,2-dihydroimidazol-1-ium bromide (PubChem CID 71394755) has the molecular formula C22H45BrN2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 1-hexadecyl-3-propyl-1,2-dihydroimidazol-1-ium bromide.
| Compound Name | 1-hexadecyl-3-propyl-1,2-dihydroimidazol-1-ium bromide |
|---|---|
| PubChem CID | 71394755 |
| Molecular Formula | C22H45BrN2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 1-hexadecyl-3-propyl-1,2-dihydroimidazol-1-ium bromide |
| SMILES | CCCCCCCCCCCCCCCC[NH+]1C=CN(CCC)C1.[Br-] |
| InChI | InChI=1S/C22H44N2.BrH/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-24-21-20-23(22-24)18-4-2;/h20-21H,3-19,22H2,1-2H3;1H |
| InChIKey | DWZHKDTWXKAZQI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|