C19H19F2NO5 — CID 175227259
1-[(Z)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-3,4,5-trimethoxy-2-nitrobenzene (PubChem CID 175227259) has the molecular formula C19H19F2NO5 and a molecular weight of 379.36 g/mol. Its IUPAC name is 1-[(Z)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-3,4,5-trimethoxy-2-nitrobenzene.
| Compound Name | 1-[(Z)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-3,4,5-trimethoxy-2-nitrobenzene |
|---|---|
| PubChem CID | 175227259 |
| Molecular Formula | C19H19F2NO5 |
| Molecular Weight | 379.36 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 1-[(Z)-2-[4-(1,1-difluoroethyl)phenyl]ethenyl]-3,4,5-trimethoxy-2-nitrobenzene |
| SMILES | COc1cc(/C=C\c2ccc(C(C)(F)F)cc2)c([N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C19H19F2NO5/c1-19(20,21)14-9-6-12(7-10-14)5-8-13-11-15(25-2)17(26-3)18(27-4)16(13)22(23)24/h5-11H,1-4H3/b8-5- |
| InChIKey | OTTAJFXTAPLNOT-YVMONPNESA-N |
| XLogP | 4.90 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|