C24H21NO4 — CID 175228220
3-methyl-2-[(3-methyl-1-benzofuran-2-yl)amino]-6-phenylmethoxybenzoic acid (PubChem CID 175228220) has the molecular formula C24H21NO4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-methyl-2-[(3-methyl-1-benzofuran-2-yl)amino]-6-phenylmethoxybenzoic acid.
| Compound Name | 3-methyl-2-[(3-methyl-1-benzofuran-2-yl)amino]-6-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 175228220 |
| Molecular Formula | C24H21NO4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 3-methyl-2-[(3-methyl-1-benzofuran-2-yl)amino]-6-phenylmethoxybenzoic acid |
| SMILES | Cc1ccc(OCc2ccccc2)c(C(=O)O)c1Nc1oc2ccccc2c1C |
| InChI | InChI=1S/C24H21NO4/c1-15-12-13-20(28-14-17-8-4-3-5-9-17)21(24(26)27)22(15)25-23-16(2)18-10-6-7-11-19(18)29-23/h3-13,25H,14H2,1-2H3,(H,26,27) |
| InChIKey | FUHWJSWURFMIGT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |