C9H12N2O6S2 — CID 175228236
[amino(methylsulfonyl)methyl] 2-sulfamoylbenzoate (PubChem CID 175228236) has the molecular formula C9H12N2O6S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is [amino(methylsulfonyl)methyl] 2-sulfamoylbenzoate.
| Compound Name | [amino(methylsulfonyl)methyl] 2-sulfamoylbenzoate |
|---|---|
| PubChem CID | 175228236 |
| Molecular Formula | C9H12N2O6S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | [amino(methylsulfonyl)methyl] 2-sulfamoylbenzoate |
| SMILES | CS(=O)(=O)C(N)OC(=O)c1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C9H12N2O6S2/c1-18(13,14)9(10)17-8(12)6-4-2-3-5-7(6)19(11,15)16/h2-5,9H,10H2,1H3,(H2,11,15,16) |
| InChIKey | HGJUCYPQLMQRNU-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 146.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|